C15H20O11 — CID 134940268
[(2S,5S)-2,3,5,6-tetraacetyloxyoxan-4-yl] acetate (PubChem CID 134940268) has the molecular formula C15H20O11 and a molecular weight of 376.31 g/mol. Its IUPAC name is [(2S,5S)-2,3,5,6-tetraacetyloxyoxan-4-yl] acetate.
| Compound Name | [(2S,5S)-2,3,5,6-tetraacetyloxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 134940268 |
| Molecular Formula | C15H20O11 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [(2S,5S)-2,3,5,6-tetraacetyloxyoxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)O[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O11/c1-6(16)21-11-12(22-7(2)17)14(24-9(4)19)26-15(25-10(5)20)13(11)23-8(3)18/h11-15H,1-5H3/t11?,12-,13?,14?,15+/m0/s1 |
| InChIKey | ZPGQPBAIOFNYIX-TZZMIGRFSA-N |
| XLogP | -0.41 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|