C13H19NO9 — CID 66524143
[(3S,5R,6S)-2,3,6-triacetyloxy-5-aminooxan-4-yl] acetate (PubChem CID 66524143) has the molecular formula C13H19NO9 and a molecular weight of 333.29 g/mol. Its IUPAC name is [(3S,5R,6S)-2,3,6-triacetyloxy-5-aminooxan-4-yl] acetate.
| Compound Name | [(3S,5R,6S)-2,3,6-triacetyloxy-5-aminooxan-4-yl] acetate |
|---|---|
| PubChem CID | 66524143 |
| Molecular Formula | C13H19NO9 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(3S,5R,6S)-2,3,6-triacetyloxy-5-aminooxan-4-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](OC(C)=O)[C@H](N)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H19NO9/c1-5(15)19-10-9(14)12(21-7(3)17)23-13(22-8(4)18)11(10)20-6(2)16/h9-13H,14H2,1-4H3/t9-,10?,11+,12-,13?/m1/s1 |
| InChIKey | VDKGQEPOIXOVBU-NQLXBKOGSA-N |
| XLogP | -1.01 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|