C14H23NO13S — CID 146159643
sulfuric acid;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate (PubChem CID 146159643) has the molecular formula C14H23NO13S and a molecular weight of 445.40 g/mol. Its IUPAC name is sulfuric acid;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate.
| Compound Name | sulfuric acid;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 146159643 |
| Molecular Formula | C14H23NO13S |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | sulfuric acid;(3,4,6-triacetyloxy-5-aminooxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(N)C(OC(C)=O)C1OC(C)=O.O=S(=O)(O)O |
| InChI | InChI=1S/C14H21NO9.H2O4S/c1-6(16)20-5-10-12(21-7(2)17)13(22-8(3)18)11(15)14(24-10)23-9(4)19;1-5(2,3)4/h10-14H,5,15H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | SKCWOJZZJHMKCU-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 215.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|