C12H19NO8 — CID 86736895
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-amino-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 86736895) has the molecular formula C12H19NO8 and a molecular weight of 305.28 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-amino-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-amino-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86736895 |
| Molecular Formula | C12H19NO8 |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-amino-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O)[C@H](N)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H19NO8/c1-5(14)18-4-8-10(19-6(2)15)11(20-7(3)16)9(13)12(17)21-8/h8-12,17H,4,13H2,1-3H3/t8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | CPMQHYGMLDFCGW-OZRWLHRGSA-N |
| XLogP | -1.54 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|