C14H22O7 — CID 71155336
[(3S,4R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl acetate (PubChem CID 71155336) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is [(3S,4R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71155336 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [(3S,4R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](C)C(C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H22O7/c1-7-8(2)19-12(6-18-9(3)15)14(21-11(5)17)13(7)20-10(4)16/h7-8,12-14H,6H2,1-5H3/t7?,8-,12?,13+,14+/m0/s1 |
| InChIKey | ZEESUMVUTRKGDY-HYGWVAMZSA-N |
| XLogP | 0.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|