C11H18O7 — CID 121245910
[(5S)-3-acetyloxy-4,6-dihydroxy-5-methyloxan-2-yl]methyl acetate (PubChem CID 121245910) has the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. Its IUPAC name is [(5S)-3-acetyloxy-4,6-dihydroxy-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(5S)-3-acetyloxy-4,6-dihydroxy-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 121245910 |
| Molecular Formula | C11H18O7 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | [(5S)-3-acetyloxy-4,6-dihydroxy-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O)[C@@H](C)C(O)C1OC(C)=O |
| InChI | InChI=1S/C11H18O7/c1-5-9(14)10(17-7(3)13)8(18-11(5)15)4-16-6(2)12/h5,8-11,14-15H,4H2,1-3H3/t5-,8?,9?,10?,11?/m0/s1 |
| InChIKey | WREKRXCSRIOXNE-NORXJEGBSA-N |
| XLogP | -0.80 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |