C12H20O7 — CID 59701764
(3-acetyloxy-4-hydroxy-6-methoxy-5-methyloxan-2-yl)methyl acetate (PubChem CID 59701764) has the molecular formula C12H20O7 and a molecular weight of 276.29 g/mol. Its IUPAC name is (3-acetyloxy-4-hydroxy-6-methoxy-5-methyloxan-2-yl)methyl acetate.
| Compound Name | (3-acetyloxy-4-hydroxy-6-methoxy-5-methyloxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 59701764 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (3-acetyloxy-4-hydroxy-6-methoxy-5-methyloxan-2-yl)methyl acetate |
| SMILES | COC1OC(COC(C)=O)C(OC(C)=O)C(O)C1C |
| InChI | InChI=1S/C12H20O7/c1-6-10(15)11(18-8(3)14)9(5-17-7(2)13)19-12(6)16-4/h6,9-12,15H,5H2,1-4H3 |
| InChIKey | WPICGVMVHDZJOG-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |