C14H21NO9 — CID 134350670
[(2R,3R,4R,5R)-3,5-diacetyloxy-4-carbamoyloxy-6-methyloxan-2-yl]methyl acetate (PubChem CID 134350670) has the molecular formula C14H21NO9 and a molecular weight of 347.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,5-diacetyloxy-4-carbamoyloxy-6-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,5-diacetyloxy-4-carbamoyloxy-6-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134350670 |
| Molecular Formula | C14H21NO9 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(2R,3R,4R,5R)-3,5-diacetyloxy-4-carbamoyloxy-6-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(C)[C@@H](OC(C)=O)[C@@H](OC(N)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H21NO9/c1-6-11(22-8(3)17)13(24-14(15)19)12(23-9(4)18)10(21-6)5-20-7(2)16/h6,10-13H,5H2,1-4H3,(H2,15,19)/t6?,10-,11-,12-,13-/m1/s1 |
| InChIKey | IONMSFZUVJZFCG-OYKGETOKSA-N |
| XLogP | -0.34 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|