C13H20O9 — CID 134937092
[(3S,5R,6R)-3,5-diacetyloxy-2,6-dimethoxyoxan-4-yl] acetate (PubChem CID 134937092) has the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. Its IUPAC name is [(3S,5R,6R)-3,5-diacetyloxy-2,6-dimethoxyoxan-4-yl] acetate.
| Compound Name | [(3S,5R,6R)-3,5-diacetyloxy-2,6-dimethoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 134937092 |
| Molecular Formula | C13H20O9 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [(3S,5R,6R)-3,5-diacetyloxy-2,6-dimethoxyoxan-4-yl] acetate |
| SMILES | COC1O[C@@H](OC)[C@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20O9/c1-6(14)19-9-10(20-7(2)15)12(17-4)22-13(18-5)11(9)21-8(3)16/h9-13H,1-5H3/t9?,10-,11+,12-,13?/m1/s1 |
| InChIKey | SFWQYPDQTKWHBA-VFIJVLHUSA-N |
| XLogP | -0.24 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|