C11H20O6 — CID 22214876
[(2R,3R,4S,5S,6S)-4,5,6-trimethoxy-2-methyloxan-3-yl] acetate (PubChem CID 22214876) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4,5,6-trimethoxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-4,5,6-trimethoxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 22214876 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4,5,6-trimethoxy-2-methyloxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](OC(C)=O)[C@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C11H20O6/c1-6-8(17-7(2)12)9(13-3)10(14-4)11(15-5)16-6/h6,8-11H,1-5H3/t6-,8-,9+,10+,11+/m1/s1 |
| InChIKey | QSPJYJSAHLCWOM-OLSRCRKSSA-N |
| XLogP | 0.34 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |