C14H22O8 — CID 54172413
(4,5-diacetyloxy-2-ethyl-6-methoxyoxan-3-yl) acetate (PubChem CID 54172413) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is (4,5-diacetyloxy-2-ethyl-6-methoxyoxan-3-yl) acetate.
| Compound Name | (4,5-diacetyloxy-2-ethyl-6-methoxyoxan-3-yl) acetate |
|---|---|
| PubChem CID | 54172413 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (4,5-diacetyloxy-2-ethyl-6-methoxyoxan-3-yl) acetate |
| SMILES | CCC1OC(OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H22O8/c1-6-10-11(19-7(2)15)12(20-8(3)16)13(21-9(4)17)14(18-5)22-10/h10-14H,6H2,1-5H3 |
| InChIKey | OVYJJVNUVWQHBH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|