C16H26O8 — CID 102301482
[(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-butyl-6-methoxyoxan-3-yl] acetate (PubChem CID 102301482) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-butyl-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-butyl-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 102301482 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-4,5-diacetyloxy-2-butyl-6-methoxyoxan-3-yl] acetate |
| SMILES | CCCC[C@H]1O[C@H](OC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H26O8/c1-6-7-8-12-13(21-9(2)17)14(22-10(3)18)15(23-11(4)19)16(20-5)24-12/h12-16H,6-8H2,1-5H3/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | IIFQUCLZEOTAMG-SUJAAXHWSA-N |
| XLogP | 1.34 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|