C18H28O10S — CID 11144606
ethyl 2-[[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methylsulfanyl]propanoate (PubChem CID 11144606) has the molecular formula C18H28O10S and a molecular weight of 436.48 g/mol. Its IUPAC name is ethyl 2-[[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methylsulfanyl]propanoate.
| Compound Name | ethyl 2-[[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 11144606 |
| Molecular Formula | C18H28O10S |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | ethyl 2-[[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]methylsulfanyl]propanoate |
| SMILES | CCOC(=O)C(C)SC[C@H]1O[C@@H](OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H28O10S/c1-7-24-17(22)9(2)29-8-13-14(25-10(3)19)15(26-11(4)20)16(27-12(5)21)18(23-6)28-13/h9,13-16,18H,7-8H2,1-6H3/t9?,13-,14-,15+,16-,18-/m1/s1 |
| InChIKey | XNOOJKVTGPNIHZ-MAXXXDEHSA-N |
| XLogP | 0.84 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|