C12H18O7S — CID 11001264
[(2S,3S,4S)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-methoxyoxolan-3-yl] acetate (PubChem CID 11001264) has the molecular formula C12H18O7S and a molecular weight of 306.34 g/mol. Its IUPAC name is [(2S,3S,4S)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-methoxyoxolan-3-yl] acetate.
| Compound Name | [(2S,3S,4S)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-methoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11001264 |
| Molecular Formula | C12H18O7S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [(2S,3S,4S)-4-acetyloxy-2-(acetylsulfanylmethyl)-5-methoxyoxolan-3-yl] acetate |
| SMILES | COC1O[C@H](CSC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H18O7S/c1-6(13)17-10-9(5-20-8(3)15)19-12(16-4)11(10)18-7(2)14/h9-12H,5H2,1-4H3/t9-,10-,11+,12?/m1/s1 |
| InChIKey | PRQVXQAXSOAMOI-YIBTVLSRSA-N |
| XLogP | 0.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|