C31H46O17S2 — CID 10996299
[(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-acetylsulfanylbutylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10996299) has the molecular formula C31H46O17S2 and a molecular weight of 754.83 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-acetylsulfanylbutylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-acetylsulfanylbutylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10996299 |
| Molecular Formula | C31H46O17S2 |
| Molecular Weight | 754.83 g/mol |
| Exact Mass | 754.22 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-acetylsulfanylbutylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@H](O[C@@H]2O[C@H](CSCCCCSC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H46O17S2/c1-15(32)40-13-22-24(26(42-17(3)34)28(44-19(5)36)30(39-8)46-22)48-31-29(45-20(6)37)27(43-18(4)35)25(41-16(2)33)23(47-31)14-49-11-9-10-12-50-21(7)38/h22-31H,9-14H2,1-8H3/t22-,23-,24+,25+,26+,27+,28-,29-,30-,31+/m1/s1 |
| InChIKey | YERVKAZDDYULJE-VBEVKOTHSA-N |
| XLogP | 1.48 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.83 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|