C30H46O16S2 — CID 10974614
[(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(5-sulfanylpentylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10974614) has the molecular formula C30H46O16S2 and a molecular weight of 726.82 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(5-sulfanylpentylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(5-sulfanylpentylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10974614 |
| Molecular Formula | C30H46O16S2 |
| Molecular Weight | 726.82 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-diacetyloxy-6-methoxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(5-sulfanylpentylsulfanylmethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@H](O[C@@H]2O[C@H](CSCCCCCS)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H46O16S2/c1-15(31)38-13-21-23(25(40-17(3)33)27(42-19(5)35)29(37-7)44-21)46-30-28(43-20(6)36)26(41-18(4)34)24(39-16(2)32)22(45-30)14-48-12-10-8-9-11-47/h21-30,47H,8-14H2,1-7H3/t21-,22-,23+,24+,25+,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | UNTCAPUMOWTNIL-DIJPGLQPSA-N |
| XLogP | 1.52 |
| TPSA | 194.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.82 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|