C22H34O10 — CID 101194687
[(2R,3R,4S,5R,6S)-2-[3-[(2R,3S)-3-acetyloxan-2-yl]propyl]-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate (PubChem CID 101194687) has the molecular formula C22H34O10 and a molecular weight of 458.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-2-[3-[(2R,3S)-3-acetyloxan-2-yl]propyl]-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-2-[3-[(2R,3S)-3-acetyloxan-2-yl]propyl]-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 101194687 |
| Molecular Formula | C22H34O10 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-2-[3-[(2R,3S)-3-acetyloxan-2-yl]propyl]-4,5-diacetyloxy-6-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](CCC[C@H]2OCCC[C@@H]2C(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O10/c1-12(23)16-8-7-11-28-17(16)9-6-10-18-19(29-13(2)24)20(30-14(3)25)21(31-15(4)26)22(27-5)32-18/h16-22H,6-11H2,1-5H3/t16-,17-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | BRYYWBHEOVOTFF-CBDMQDTOSA-N |
| XLogP | 1.71 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|