C14H23NO8 — CID 147641318
[4,5-diacetyloxy-6-methoxy-2-(methylaminomethyl)oxan-3-yl] acetate (PubChem CID 147641318) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-methoxy-2-(methylaminomethyl)oxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-methoxy-2-(methylaminomethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 147641318 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [4,5-diacetyloxy-6-methoxy-2-(methylaminomethyl)oxan-3-yl] acetate |
| SMILES | CNCC1OC(OC)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H23NO8/c1-7(16)20-11-10(6-15-4)23-14(19-5)13(22-9(3)18)12(11)21-8(2)17/h10-15H,6H2,1-5H3 |
| InChIKey | GHQXWQXKZGDLRP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|