C19H29NO9 — CID 140500785
[(3R,5S,6S)-4,5-diacetyloxy-2-[(cyclopentanecarbonylamino)methyl]-6-methoxyoxan-3-yl] acetate (PubChem CID 140500785) has the molecular formula C19H29NO9 and a molecular weight of 415.44 g/mol. Its IUPAC name is [(3R,5S,6S)-4,5-diacetyloxy-2-[(cyclopentanecarbonylamino)methyl]-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(3R,5S,6S)-4,5-diacetyloxy-2-[(cyclopentanecarbonylamino)methyl]-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 140500785 |
| Molecular Formula | C19H29NO9 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [(3R,5S,6S)-4,5-diacetyloxy-2-[(cyclopentanecarbonylamino)methyl]-6-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1OC(CNC(=O)C2CCCC2)[C@@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H29NO9/c1-10(21)26-15-14(9-20-18(24)13-7-5-6-8-13)29-19(25-4)17(28-12(3)23)16(15)27-11(2)22/h13-17,19H,5-9H2,1-4H3,(H,20,24)/t14?,15-,16?,17+,19+/m1/s1 |
| InChIKey | GISIGXSJHLPGNA-DUAXXBJTSA-N |
| XLogP | 0.46 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|