C15H23NO8 — CID 172734488
[(2R,3R,4R)-4,5-diacetyloxy-2-[(2-methylpropanoylamino)methyl]oxolan-3-yl] acetate (PubChem CID 172734488) has the molecular formula C15H23NO8 and a molecular weight of 345.35 g/mol. Its IUPAC name is [(2R,3R,4R)-4,5-diacetyloxy-2-[(2-methylpropanoylamino)methyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4,5-diacetyloxy-2-[(2-methylpropanoylamino)methyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 172734488 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [(2R,3R,4R)-4,5-diacetyloxy-2-[(2-methylpropanoylamino)methyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CNC(=O)C(C)C)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H23NO8/c1-7(2)14(20)16-6-11-12(21-8(3)17)13(22-9(4)18)15(24-11)23-10(5)19/h7,11-13,15H,6H2,1-5H3,(H,16,20)/t11-,12-,13-,15?/m1/s1 |
| InChIKey | IFYYSXORSHYCHE-OSBVZDBCSA-N |
| XLogP | -0.09 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|