C21H25NO10 — CID 22088773
[4,5,6-triacetyloxy-2-(benzamidomethyl)oxan-3-yl] acetate (PubChem CID 22088773) has the molecular formula C21H25NO10 and a molecular weight of 451.43 g/mol. Its IUPAC name is [4,5,6-triacetyloxy-2-(benzamidomethyl)oxan-3-yl] acetate.
| Compound Name | [4,5,6-triacetyloxy-2-(benzamidomethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 22088773 |
| Molecular Formula | C21H25NO10 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [4,5,6-triacetyloxy-2-(benzamidomethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)OC1OC(CNC(=O)c2ccccc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H25NO10/c1-11(23)28-17-16(10-22-20(27)15-8-6-5-7-9-15)32-21(31-14(4)26)19(30-13(3)25)18(17)29-12(2)24/h5-9,16-19,21H,10H2,1-4H3,(H,22,27) |
| InChIKey | PXUSXRWIFQOZFN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|