C22H20O9 — CID 58625785
[(2S)-4,5-diacetyloxy-2-benzoyloxyoxolan-3-yl] benzoate (PubChem CID 58625785) has the molecular formula C22H20O9 and a molecular weight of 428.39 g/mol. Its IUPAC name is [(2S)-4,5-diacetyloxy-2-benzoyloxyoxolan-3-yl] benzoate.
| Compound Name | [(2S)-4,5-diacetyloxy-2-benzoyloxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58625785 |
| Molecular Formula | C22H20O9 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(2S)-4,5-diacetyloxy-2-benzoyloxyoxolan-3-yl] benzoate |
| SMILES | CC(=O)OC1O[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C22H20O9/c1-13(23)27-17-18(29-19(25)15-9-5-3-6-10-15)22(31-21(17)28-14(2)24)30-20(26)16-11-7-4-8-12-16/h3-12,17-18,21-22H,1-2H3/t17?,18?,21?,22-/m1/s1 |
| InChIKey | NTVFZJBTFFSTOP-HGNWCAPWSA-N |
| XLogP | 2.25 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|