C25H20O8 — CID 102284736
[(2R,3S,4R,5R)-2,5-dibenzoyloxy-4-hydroxyoxolan-3-yl] benzoate (PubChem CID 102284736) has the molecular formula C25H20O8 and a molecular weight of 448.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,5-dibenzoyloxy-4-hydroxyoxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4R,5R)-2,5-dibenzoyloxy-4-hydroxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 102284736 |
| Molecular Formula | C25H20O8 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(2R,3S,4R,5R)-2,5-dibenzoyloxy-4-hydroxyoxolan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1O[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C25H20O8/c26-19-20(30-21(27)16-10-4-1-5-11-16)25(32-23(29)18-14-8-3-9-15-18)33-24(19)31-22(28)17-12-6-2-7-13-17/h1-15,19-20,24-26H/t19-,20+,24+,25+/m1/s1 |
| InChIKey | POIADWAYRQEOMO-PXTBKIQTSA-N |
| XLogP | 2.97 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|