C13H16O6 — CID 10611936
[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] benzoate (PubChem CID 10611936) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] benzoate.
| Compound Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] benzoate |
|---|---|
| PubChem CID | 10611936 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] benzoate |
| SMILES | C[C@@H]1O[C@@H](OC(=O)c2ccccc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16O6/c1-7-9(14)10(15)11(16)13(18-7)19-12(17)8-5-3-2-4-6-8/h2-7,9-11,13-16H,1H3/t7-,9-,10+,11+,13-/m0/s1 |
| InChIKey | QLJMLBNUXYMSGG-SODMMLJRSA-N |
| XLogP | -0.33 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |