C14H19NO6 — CID 23874506
(3,4,5-trihydroxy-6-methyloxan-2-yl) 2-(methylamino)benzoate (PubChem CID 23874506) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3,4,5-trihydroxy-6-methyloxan-2-yl) 2-(methylamino)benzoate.
| Compound Name | (3,4,5-trihydroxy-6-methyloxan-2-yl) 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 23874506 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3,4,5-trihydroxy-6-methyloxan-2-yl) 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)OC1OC(C)C(O)C(O)C1O |
| InChI | InChI=1S/C14H19NO6/c1-7-10(16)11(17)12(18)14(20-7)21-13(19)8-5-3-4-6-9(8)15-2/h3-7,10-12,14-18H,1-2H3 |
| InChIKey | XLGJBANZFAQPOK-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |