C28H30N2O13 — CID 71524390
1-O-[(2S,3R,4R,5S,6S)-4-acetyloxy-3,5-dihydroxy-6-methyloxan-2-yl] 6-O-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1,6-dicarboxylate (PubChem CID 71524390) has the molecular formula C28H30N2O13 and a molecular weight of 602.55 g/mol. Its IUPAC name is 1-O-[(2S,3R,4R,5S,6S)-4-acetyloxy-3,5-dihydroxy-6-methyloxan-2-yl] 6-O-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1,6-dicarboxylate.
| Compound Name | 1-O-[(2S,3R,4R,5S,6S)-4-acetyloxy-3,5-dihydroxy-6-methyloxan-2-yl] 6-O-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 71524390 |
| Molecular Formula | C28H30N2O13 |
| Molecular Weight | 602.55 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 1-O-[(2S,3R,4R,5S,6S)-4-acetyloxy-3,5-dihydroxy-6-methyloxan-2-yl] 6-O-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1,6-dicarboxylate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](C)O[C@@H](OC(=O)c2cccc3nc4c(C(=O)O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)cccc4nc23)[C@@H]1O |
| InChI | InChI=1S/C28H30N2O13/c1-10-19(32)21(34)22(35)27(39-10)42-25(37)13-6-4-8-15-17(13)29-16-9-5-7-14(18(16)30-15)26(38)43-28-23(36)24(41-12(3)31)20(33)11(2)40-28/h4-11,19-24,27-28,32-36H,1-3H3/t10-,11-,19-,20-,21+,22+,23+,24+,27-,28-/m0/s1 |
| InChIKey | DZOLRXLUHPQHDI-SLNKWHCOSA-N |
| XLogP | -0.68 |
| TPSA | 224.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.55 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|