C19H18N2O6 — CID 139585741
[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1-carboxylate (PubChem CID 139585741) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1-carboxylate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1-carboxylate |
|---|---|
| PubChem CID | 139585741 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] phenazine-1-carboxylate |
| SMILES | C[C@@H]1O[C@H](OC(=O)c2cccc3nc4ccccc4nc23)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H18N2O6/c1-9-15(22)16(23)17(24)19(26-9)27-18(25)10-5-4-8-13-14(10)21-12-7-3-2-6-11(12)20-13/h2-9,15-17,19,22-24H,1H3/t9-,15-,16+,17+,19+/m0/s1 |
| InChIKey | CQFWUUXJZDGIDM-UXLIUCIESA-N |
| XLogP | 0.77 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|