C11H14O7 — CID 10825072
[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] furan-2-carboxylate (PubChem CID 10825072) has the molecular formula C11H14O7 and a molecular weight of 258.23 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] furan-2-carboxylate.
| Compound Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 10825072 |
| Molecular Formula | C11H14O7 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] furan-2-carboxylate |
| SMILES | C[C@@H]1O[C@@H](OC(=O)c2ccco2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H14O7/c1-5-7(12)8(13)9(14)11(17-5)18-10(15)6-3-2-4-16-6/h2-5,7-9,11-14H,1H3/t5-,7-,8+,9+,11-/m0/s1 |
| InChIKey | UHIBOFDBVRZXMI-VQMAVXFHSA-N |
| XLogP | -0.74 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |