C26H28N2O12 — CID 78096924
bis(3,4,5-trihydroxy-6-methyloxan-2-yl) phenazine-1,6-dicarboxylate (PubChem CID 78096924) has the molecular formula C26H28N2O12 and a molecular weight of 560.51 g/mol. Its IUPAC name is bis(3,4,5-trihydroxy-6-methyloxan-2-yl) phenazine-1,6-dicarboxylate.
| Compound Name | bis(3,4,5-trihydroxy-6-methyloxan-2-yl) phenazine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 78096924 |
| Molecular Formula | C26H28N2O12 |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | bis(3,4,5-trihydroxy-6-methyloxan-2-yl) phenazine-1,6-dicarboxylate |
| SMILES | CC1OC(OC(=O)c2cccc3nc4c(C(=O)OC5OC(C)C(O)C(O)C5O)cccc4nc23)C(O)C(O)C1O |
| InChI | InChI=1S/C26H28N2O12/c1-9-17(29)19(31)21(33)25(37-9)39-23(35)11-5-3-7-13-15(11)27-14-8-4-6-12(16(14)28-13)24(36)40-26-22(34)20(32)18(30)10(2)38-26/h3-10,17-22,25-26,29-34H,1-2H3 |
| InChIKey | JDJDBXTXLCFSLK-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 218.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|