C21H22N2O7 — CID 162896028
[(2S,3S,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl] 6-[(1S)-1-hydroxyethyl]phenazine-1-carboxylate (PubChem CID 162896028) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl] 6-[(1S)-1-hydroxyethyl]phenazine-1-carboxylate.
| Compound Name | [(2S,3S,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl] 6-[(1S)-1-hydroxyethyl]phenazine-1-carboxylate |
|---|---|
| PubChem CID | 162896028 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl] 6-[(1S)-1-hydroxyethyl]phenazine-1-carboxylate |
| SMILES | C[C@H](O)c1cccc2nc3c(C(=O)O[C@@H]4[C@@H](O)[C@H](C)O[C@H](O)[C@H]4O)cccc3nc12 |
| InChI | InChI=1S/C21H22N2O7/c1-9(24)11-5-3-7-13-15(11)22-14-8-4-6-12(16(14)23-13)20(27)30-19-17(25)10(2)29-21(28)18(19)26/h3-10,17-19,21,24-26,28H,1-2H3/t9-,10-,17-,18-,19+,21-/m0/s1 |
| InChIKey | PUQJQWLXPKZAPU-KYQCRLOCSA-N |
| XLogP | 0.82 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|