C14H19NO6 — CID 51693364
[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-(methylamino)benzoate (PubChem CID 51693364) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-(methylamino)benzoate.
| Compound Name | [(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 51693364 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2-(methylamino)benzoate |
| SMILES | CNc1ccccc1C(=O)O[C@@H]1O[C@@H](C)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO6/c1-7-10(16)11(17)12(18)14(20-7)21-13(19)8-5-3-4-6-9(8)15-2/h3-7,10-12,14-18H,1-2H3/t7-,10+,11-,12-,14-/m0/s1 |
| InChIKey | XLGJBANZFAQPOK-XDJQCPJISA-N |
| XLogP | -0.29 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |