C19H21NO7 — CID 22822590
phenyl 2-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate (PubChem CID 22822590) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is phenyl 2-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate.
| Compound Name | phenyl 2-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate |
|---|---|
| PubChem CID | 22822590 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | phenyl 2-[[(3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyamino]benzoate |
| SMILES | C[C@@H]1OC(ONc2ccccc2C(=O)Oc2ccccc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H21NO7/c1-11-15(21)16(22)17(23)19(25-11)27-20-14-10-6-5-9-13(14)18(24)26-12-7-3-2-4-8-12/h2-11,15-17,19-23H,1H3/t11-,15-,16+,17+,19?/m0/s1 |
| InChIKey | BYBDMJKZFMZTBK-KLCMARIPSA-N |
| XLogP | 1.08 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|