C21H18O10 — CID 45113312
2-O,3-O,4-O,5-O-tetramethyl 1-O-phenyl benzene-1,2,3,4,5-pentacarboxylate (PubChem CID 45113312) has the molecular formula C21H18O10 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2-O,3-O,4-O,5-O-tetramethyl 1-O-phenyl benzene-1,2,3,4,5-pentacarboxylate.
| Compound Name | 2-O,3-O,4-O,5-O-tetramethyl 1-O-phenyl benzene-1,2,3,4,5-pentacarboxylate |
|---|---|
| PubChem CID | 45113312 |
| Molecular Formula | C21H18O10 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-O,3-O,4-O,5-O-tetramethyl 1-O-phenyl benzene-1,2,3,4,5-pentacarboxylate |
| SMILES | COC(=O)c1cc(C(=O)Oc2ccccc2)c(C(=O)OC)c(C(=O)OC)c1C(=O)OC |
| InChI | InChI=1S/C21H18O10/c1-27-17(22)12-10-13(18(23)31-11-8-6-5-7-9-11)15(20(25)29-3)16(21(26)30-4)14(12)19(24)28-2/h5-10H,1-4H3 |
| InChIKey | RVLSLBVXSVADBV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|