C20H14O6 — CID 154114345
diphenyl 4,6-dihydroxybenzene-1,3-dicarboxylate (PubChem CID 154114345) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is diphenyl 4,6-dihydroxybenzene-1,3-dicarboxylate.
| Compound Name | diphenyl 4,6-dihydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 154114345 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | diphenyl 4,6-dihydroxybenzene-1,3-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)c1cc(C(=O)Oc2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C20H14O6/c21-17-12-18(22)16(20(24)26-14-9-5-2-6-10-14)11-15(17)19(23)25-13-7-3-1-4-8-13/h1-12,21-22H |
| InChIKey | RVRAPUKCTZCFRK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|