C40H34O14 — CID 161221289
benzene-1,4-diol;tris(2-hydroxybenzoic acid);phenyl 2-hydroxybenzoate (PubChem CID 161221289) has the molecular formula C40H34O14 and a molecular weight of 738.70 g/mol. Its IUPAC name is benzene-1,4-diol;tris(2-hydroxybenzoic acid);phenyl 2-hydroxybenzoate.
| Compound Name | benzene-1,4-diol;tris(2-hydroxybenzoic acid);phenyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 161221289 |
| Molecular Formula | C40H34O14 |
| Molecular Weight | 738.70 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | benzene-1,4-diol;tris(2-hydroxybenzoic acid);phenyl 2-hydroxybenzoate |
| SMILES | O=C(O)c1ccccc1O.O=C(O)c1ccccc1O.O=C(O)c1ccccc1O.O=C(Oc1ccccc1)c1ccccc1O.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C13H10O3.3C7H6O3.C6H6O2/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10;3*8-6-4-2-1-3-5(6)7(9)10;7-5-1-2-6(8)4-3-5/h1-9,14H;3*1-4,8H,(H,9,10);1-4,7-8H |
| InChIKey | UXNVJRPXFFFVPT-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 259.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|