C26H20O6 — CID 174808310
benzene-1,3-diol;diphenyl benzene-1,2-dicarboxylate (PubChem CID 174808310) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is benzene-1,3-diol;diphenyl benzene-1,2-dicarboxylate.
| Compound Name | benzene-1,3-diol;diphenyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 174808310 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | benzene-1,3-diol;diphenyl benzene-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccccc1)c1ccccc1C(=O)Oc1ccccc1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C20H14O4.C6H6O2/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;7-5-2-1-3-6(8)4-5/h1-14H;1-4,7-8H |
| InChIKey | VFQNPFNKYMYSJA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|