C21H20O7P+ — CID 158752634
diphenyl benzene-1,2-dicarboxylate;trihydroxy(methyl)phosphanium (PubChem CID 158752634) has the molecular formula C21H20O7P+ and a molecular weight of 415.36 g/mol. Its IUPAC name is diphenyl benzene-1,2-dicarboxylate;trihydroxy(methyl)phosphanium.
| Compound Name | diphenyl benzene-1,2-dicarboxylate;trihydroxy(methyl)phosphanium |
|---|---|
| PubChem CID | 158752634 |
| Molecular Formula | C21H20O7P+ |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | diphenyl benzene-1,2-dicarboxylate;trihydroxy(methyl)phosphanium |
| SMILES | C[P+](O)(O)O.O=C(Oc1ccccc1)c1ccccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H14O4.CH6O3P/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;1-5(2,3)4/h1-14H;2-4H,1H3/q;+1 |
| InChIKey | NHAXCLNIEIWLIM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|