About phenyl 2-iodobenzoate
phenyl 2-iodobenzoate (PubChem CID 11416063) has the molecular formula C13H9IO2
and a molecular weight of 324.12 g/mol. Its IUPAC name is phenyl 2-iodobenzoate.
Molecular Properties
| Compound Name | phenyl 2-iodobenzoate |
| PubChem CID | 11416063 |
| Molecular Formula | C13H9IO2 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | phenyl 2-iodobenzoate |
| SMILES | O=C(Oc1ccccc1)c1ccccc1I |
| InChI | InChI=1S/C13H9IO2/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9H |
| InChIKey | HUXVVBQIQZPBNL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-iodobenzoate?
The IUPAC name of phenyl 2-iodobenzoate (CID 11416063) is phenyl 2-iodobenzoate.
What is the SMILES notation for phenyl 2-iodobenzoate?
The canonical SMILES for phenyl 2-iodobenzoate is O=C(Oc1ccccc1)c1ccccc1I.
What is the InChIKey of phenyl 2-iodobenzoate?
The InChIKey is HUXVVBQIQZPBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9IO2/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9H.
What are the key properties of phenyl 2-iodobenzoate?
phenyl 2-iodobenzoate has a molecular weight of 324.12 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-iodobenzoate is sourced from PubChem (CID 11416063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).