C24H22O5 — CID 6426010
2-O-(4-methoxyphenyl) 1-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate (PubChem CID 6426010) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-O-(4-methoxyphenyl) 1-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(4-methoxyphenyl) 1-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6426010 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-O-(4-methoxyphenyl) 1-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate |
| SMILES | COc1ccc(OC(=O)c2ccccc2C(=O)Oc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H22O5/c1-16(2)17-8-10-19(11-9-17)28-23(25)21-6-4-5-7-22(21)24(26)29-20-14-12-18(27-3)13-15-20/h4-16H,1-3H3 |
| InChIKey | FDLQIVXCBFJSRP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|