C24H28O4 — CID 6423686
1-O-(cyclohexylmethyl) 2-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate (PubChem CID 6423686) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-O-(cyclohexylmethyl) 2-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(cyclohexylmethyl) 2-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423686 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-O-(cyclohexylmethyl) 2-O-(4-propan-2-ylphenyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)c1ccc(OC(=O)c2ccccc2C(=O)OCC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28O4/c1-17(2)19-12-14-20(15-13-19)28-24(26)22-11-7-6-10-21(22)23(25)27-16-18-8-4-3-5-9-18/h6-7,10-15,17-18H,3-5,8-9,16H2,1-2H3 |
| InChIKey | YMTSTRQVLRYEEO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|