C52H74O8 — CID 91250961
bis(cyclohexylmethyl) benzene-1,2-dicarboxylate;bis(3-ethylpentan-3-yl) benzene-1,2-dicarboxylate;1,2-xylene (PubChem CID 91250961) has the molecular formula C52H74O8 and a molecular weight of 827.16 g/mol. Its IUPAC name is bis(cyclohexylmethyl) benzene-1,2-dicarboxylate;bis(3-ethylpentan-3-yl) benzene-1,2-dicarboxylate;1,2-xylene.
| Compound Name | bis(cyclohexylmethyl) benzene-1,2-dicarboxylate;bis(3-ethylpentan-3-yl) benzene-1,2-dicarboxylate;1,2-xylene |
|---|---|
| PubChem CID | 91250961 |
| Molecular Formula | C52H74O8 |
| Molecular Weight | 827.16 g/mol |
| Exact Mass | 826.54 |
| IUPAC Name | bis(cyclohexylmethyl) benzene-1,2-dicarboxylate;bis(3-ethylpentan-3-yl) benzene-1,2-dicarboxylate;1,2-xylene |
| SMILES | CCC(CC)(CC)OC(=O)c1ccccc1C(=O)OC(CC)(CC)CC.Cc1ccccc1C.O=C(OCC1CCCCC1)c1ccccc1C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C22H30O4.C22H34O4.C8H10/c23-21(25-15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)22(24)26-16-18-11-5-2-6-12-18;1-7-21(8-2,9-3)25-19(23)17-15-13-14-16-18(17)20(24)26-22(10-4,11-5)12-6;1-7-5-3-4-6-8(7)2/h7-8,13-14,17-18H,1-6,9-12,15-16H2;13-16H,7-12H2,1-6H3;3-6H,1-2H3 |
| InChIKey | VLISRCMQYGDUMD-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.16 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|