C21H21ClO4 — CID 6423683
2-O-(3-chlorophenyl) 1-O-(cyclohexylmethyl) benzene-1,2-dicarboxylate (PubChem CID 6423683) has the molecular formula C21H21ClO4 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-O-(3-chlorophenyl) 1-O-(cyclohexylmethyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(3-chlorophenyl) 1-O-(cyclohexylmethyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423683 |
| Molecular Formula | C21H21ClO4 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-O-(3-chlorophenyl) 1-O-(cyclohexylmethyl) benzene-1,2-dicarboxylate |
| SMILES | O=C(OCC1CCCCC1)c1ccccc1C(=O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21ClO4/c22-16-9-6-10-17(13-16)26-21(24)19-12-5-4-11-18(19)20(23)25-14-15-7-2-1-3-8-15/h4-6,9-13,15H,1-3,7-8,14H2 |
| InChIKey | OPKVWMXENZQQCV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|