C20H11ClF2O4 — CID 6425951
1-O-(3-chlorophenyl) 2-O-(3,5-difluorophenyl) benzene-1,2-dicarboxylate (PubChem CID 6425951) has the molecular formula C20H11ClF2O4 and a molecular weight of 388.75 g/mol. Its IUPAC name is 1-O-(3-chlorophenyl) 2-O-(3,5-difluorophenyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(3-chlorophenyl) 2-O-(3,5-difluorophenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6425951 |
| Molecular Formula | C20H11ClF2O4 |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-O-(3-chlorophenyl) 2-O-(3,5-difluorophenyl) benzene-1,2-dicarboxylate |
| SMILES | O=C(Oc1cc(F)cc(F)c1)c1ccccc1C(=O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H11ClF2O4/c21-12-4-3-5-15(8-12)26-19(24)17-6-1-2-7-18(17)20(25)27-16-10-13(22)9-14(23)11-16/h1-11H |
| InChIKey | AOPROVUMEWONHX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|