C18H17FO4 — CID 91719768
2-O-(3-fluorophenyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate (PubChem CID 91719768) has the molecular formula C18H17FO4 and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-O-(3-fluorophenyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(3-fluorophenyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91719768 |
| Molecular Formula | C18H17FO4 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-O-(3-fluorophenyl) 1-O-(2-methylpropyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)c1ccccc1C(=O)Oc1cccc(F)c1 |
| InChI | InChI=1S/C18H17FO4/c1-12(2)11-22-17(20)15-8-3-4-9-16(15)18(21)23-14-7-5-6-13(19)10-14/h3-10,12H,11H2,1-2H3 |
| InChIKey | VBBOWYZLHUVTKQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|