C19H18F2O4 — CID 6423600
2-O-(3,5-difluorophenyl) 1-O-(2,2-dimethylpropyl) benzene-1,2-dicarboxylate (PubChem CID 6423600) has the molecular formula C19H18F2O4 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-O-(3,5-difluorophenyl) 1-O-(2,2-dimethylpropyl) benzene-1,2-dicarboxylate.
| Compound Name | 2-O-(3,5-difluorophenyl) 1-O-(2,2-dimethylpropyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6423600 |
| Molecular Formula | C19H18F2O4 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-O-(3,5-difluorophenyl) 1-O-(2,2-dimethylpropyl) benzene-1,2-dicarboxylate |
| SMILES | CC(C)(C)COC(=O)c1ccccc1C(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H18F2O4/c1-19(2,3)11-24-17(22)15-6-4-5-7-16(15)18(23)25-14-9-12(20)8-13(21)10-14/h4-10H,11H2,1-3H3 |
| InChIKey | BDHBNGWRDGJYCC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|