C13H14F4O2 — CID 91730603
2,2-dimethylpropyl 4-fluoro-2-(trifluoromethyl)benzoate (PubChem CID 91730603) has the molecular formula C13H14F4O2 and a molecular weight of 278.25 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-fluoro-2-(trifluoromethyl)benzoate.
| Compound Name | 2,2-dimethylpropyl 4-fluoro-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91730603 |
| Molecular Formula | C13H14F4O2 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2,2-dimethylpropyl 4-fluoro-2-(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)COC(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H14F4O2/c1-12(2,3)7-19-11(18)9-5-4-8(14)6-10(9)13(15,16)17/h4-6H,7H2,1-3H3 |
| InChIKey | FYMAZHRUKGZZEQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |