C14H3F9O2 — CID 91730898
(2,3,4,5,6-pentafluorophenyl) 4-fluoro-2-(trifluoromethyl)benzoate (PubChem CID 91730898) has the molecular formula C14H3F9O2 and a molecular weight of 374.16 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-fluoro-2-(trifluoromethyl)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-fluoro-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91730898 |
| Molecular Formula | C14H3F9O2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-fluoro-2-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H3F9O2/c15-4-1-2-5(6(3-4)14(21,22)23)13(24)25-12-10(19)8(17)7(16)9(18)11(12)20/h1-3H |
| InChIKey | MRCKJIILRHSKBS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|