C17H23FO4 — CID 91708924
1-O-(3-fluorophenyl) 3-O-(2-methylpropyl) 2,2-diethylpropanedioate (PubChem CID 91708924) has the molecular formula C17H23FO4 and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-O-(3-fluorophenyl) 3-O-(2-methylpropyl) 2,2-diethylpropanedioate.
| Compound Name | 1-O-(3-fluorophenyl) 3-O-(2-methylpropyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91708924 |
| Molecular Formula | C17H23FO4 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-O-(3-fluorophenyl) 3-O-(2-methylpropyl) 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OCC(C)C)C(=O)Oc1cccc(F)c1 |
| InChI | InChI=1S/C17H23FO4/c1-5-17(6-2,15(19)21-11-12(3)4)16(20)22-14-9-7-8-13(18)10-14/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | BTPJXFROOBGCLD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|