C14H19NO4 — CID 174386142
1-O-(aminomethyl) 3-O-phenyl 2,2-diethylpropanedioate (PubChem CID 174386142) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-O-(aminomethyl) 3-O-phenyl 2,2-diethylpropanedioate.
| Compound Name | 1-O-(aminomethyl) 3-O-phenyl 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 174386142 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-O-(aminomethyl) 3-O-phenyl 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OCN)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H19NO4/c1-3-14(4-2,12(16)18-10-15)13(17)19-11-8-6-5-7-9-11/h5-9H,3-4,10,15H2,1-2H3 |
| InChIKey | JGNVWXYWSOSROJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|