C19H28O4 — CID 91703244
1-O-(2-methylpropyl) 3-O-(2-phenylethyl) 2,2-diethylpropanedioate (PubChem CID 91703244) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 3-O-(2-phenylethyl) 2,2-diethylpropanedioate.
| Compound Name | 1-O-(2-methylpropyl) 3-O-(2-phenylethyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91703244 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-O-(2-methylpropyl) 3-O-(2-phenylethyl) 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OCCc1ccccc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C19H28O4/c1-5-19(6-2,18(21)23-14-15(3)4)17(20)22-13-12-16-10-8-7-9-11-16/h7-11,15H,5-6,12-14H2,1-4H3 |
| InChIKey | PYHFYKXNMBTQDQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|